import java.awt.*; import java.awt.Dialog.ModalityType; import java.awt.event.*; import javax.swing.*; import chemaxon.struc.*; import chemaxon.formats.*; import chemaxon.marvin.beans.*; /** * Dialog launcher. * @version 4.0.2, 10/08/2005 * @since Marvin 2.6, 09/14/2000 * @author Peter Csizmadia * @author Tamas Vertse */ public class DialogLauncher extends JFrame implements WindowListener, ActionListener { private static String smiles = "CN1C=NC2=C1C(=O)N(C)C(=O)N2C"; /** The MarvinSketch and MarvinView dialogs are modal if true. */ private boolean modalDialogs; public DialogLauncher() { setTitle("Marvin Dialog Launcher"); addWindowListener(this); Container contentPane = getContentPane(); contentPane.setLayout(new GridLayout(4, 1)); JCheckBox cb; JButton b; contentPane.add(b = new JButton("MarvinSketch Dialog")); b.addActionListener(this); b.setActionCommand("sketch"); contentPane.add(b = new JButton("MarvinView Dialog")); b.addActionListener(this); b.setActionCommand("view"); contentPane.add(cb = new JCheckBox("Modal")); cb.addActionListener(this); cb.setActionCommand("modal"); contentPane.add(b = new JButton("Exit")); b.addActionListener(this); b.setActionCommand("exit"); } /** Menu action performed. */ @Override public void actionPerformed(ActionEvent ev) { Object src = ev.getSource(); String cmd = ev.getActionCommand(); if(cmd.equals("modal")) { modalDialogs = ((JCheckBox)src).isSelected(); } else if(cmd.equals("sketch")) { JDialog dialog = new JDialog(this, ((modalDialogs)? ModalityType.DOCUMENT_MODAL : ModalityType.MODELESS)); dialog.setTitle("MarvinSketch Dialog"); MSketchPane sketcher = new MSketchPane(); dialog.setDefaultCloseOperation(WindowConstants.DISPOSE_ON_CLOSE); // Keyboard events are received by the dialog window but dialog.addKeyListener(sketcher); // processed by the bean dialog.getContentPane().add(sketcher); dialog.pack(); dialog.setVisible(true); } else if(cmd.equals("view")) { JDialog dialog = new JDialog(this, ((modalDialogs)? ModalityType.DOCUMENT_MODAL : ModalityType.MODELESS)); dialog.setTitle("MarvinView Dialog"); MViewPane viewer = new MViewPane(); dialog.setDefaultCloseOperation(WindowConstants.DISPOSE_ON_CLOSE); try { Molecule mol = MolImporter.importMol(smiles); viewer.setM(0, mol); } catch(Exception ex) { ex.printStackTrace(); } // Keyboard events are received by the dialog window but dialog.addKeyListener(viewer); // processed by the bean dialog.getContentPane().add(viewer); dialog.pack(); dialog.setVisible(true); } else if(cmd.equals("exit")) { System.exit(0); } } /** Does nothing */ @Override public void windowOpened(WindowEvent ev) { } /** Does nothing */ @Override public void windowClosed(WindowEvent ev) { } /** Closes the window. */ @Override public void windowClosing(WindowEvent ev) { System.exit(0); } /** Does nothing */ @Override public void windowIconified(WindowEvent ev) { } /** Does nothing */ @Override public void windowDeiconified(WindowEvent ev) { } /** Does nothing */ @Override public void windowActivated(WindowEvent ev) { } /** Does nothing */ @Override public void windowDeactivated(WindowEvent ev) { } public static void main(String[] args) { final JFrame w = new DialogLauncher(); // pack and show the window in the Swing thread to avoid deadlocks SwingUtilities.invokeLater(new Runnable() { @Override public void run() { w.pack(); w.setVisible(true); } }); } }